methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate

C10H8BrF3O2 — CID 62812084

IUPACmethyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate
SMILESCOC(=O)C(Br)Cc1cc(F)cc(F)c1F
InChIInChI=1S/C10H8BrF3O2/c1-16-10(15)7(11)3-5-2-6(12)4-8(13)9(5)14/h2,4,7H,3H2,1H3
InChIKeyMADKMRNJQPEASR-UHFFFAOYSA-N
MW297.07 g/mol
LogP2.58
Rot. Bonds3

About methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate

methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate (PubChem CID 62812084) has the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate.

Molecular Properties

Compound Namemethyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate
PubChem CID62812084
Molecular FormulaC10H8BrF3O2
Molecular Weight297.07 g/mol
Exact Mass295.97
IUPAC Namemethyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate
SMILESCOC(=O)C(Br)Cc1cc(F)cc(F)c1F
InChIInChI=1S/C10H8BrF3O2/c1-16-10(15)7(11)3-5-2-6(12)4-8(13)9(5)14/h2,4,7H,3H2,1H3
InChIKeyMADKMRNJQPEASR-UHFFFAOYSA-N
XLogP2.58
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.07
LogP ≤ 52.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate?
The IUPAC name of methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate (CID 62812084) is methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate.
What is the SMILES notation for methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate?
The canonical SMILES for methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate is COC(=O)C(Br)Cc1cc(F)cc(F)c1F.
What is the InChIKey of methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate?
The InChIKey is MADKMRNJQPEASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3O2/c1-16-10(15)7(11)3-5-2-6(12)4-8(13)9(5)14/h2,4,7H,3H2,1H3.
What are the key properties of methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate?
methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate has a molecular weight of 297.07 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-(2,3,5-trifluorophenyl)propanoate is sourced from PubChem (CID 62812084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).