C10H10BrFO3 — CID 79701348
methyl 3-(3-bromo-5-fluorophenyl)-2-hydroxypropanoate (PubChem CID 79701348) has the molecular formula C10H10BrFO3 and a molecular weight of 277.09 g/mol. Its IUPAC name is methyl 3-(3-bromo-5-fluorophenyl)-2-hydroxypropanoate.
| Compound Name | methyl 3-(3-bromo-5-fluorophenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 79701348 |
| Molecular Formula | C10H10BrFO3 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | methyl 3-(3-bromo-5-fluorophenyl)-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C10H10BrFO3/c1-15-10(14)9(13)4-6-2-7(11)5-8(12)3-6/h2-3,5,9,13H,4H2,1H3 |
| InChIKey | BQBJOARBVLZUIA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |