C11H12Br2O4 — CID 69245767
methyl 3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxypropanoate (PubChem CID 69245767) has the molecular formula C11H12Br2O4 and a molecular weight of 368.02 g/mol. Its IUPAC name is methyl 3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxypropanoate.
| Compound Name | methyl 3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 69245767 |
| Molecular Formula | C11H12Br2O4 |
| Molecular Weight | 368.02 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | methyl 3-(3,5-dibromo-4-methoxyphenyl)-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)Cc1cc(Br)c(OC)c(Br)c1 |
| InChI | InChI=1S/C11H12Br2O4/c1-16-10-7(12)3-6(4-8(10)13)5-9(14)11(15)17-2/h3-4,9,14H,5H2,1-2H3 |
| InChIKey | DLOBVHAEPNAEHS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.02 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |