C10H13Br2ClN2O2 — CID 11545546
methyl (2R)-2-amino-3-(4-amino-3,5-dibromophenyl)propanoate;hydrochloride (PubChem CID 11545546) has the molecular formula C10H13Br2ClN2O2 and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-(4-amino-3,5-dibromophenyl)propanoate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-3-(4-amino-3,5-dibromophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 11545546 |
| Molecular Formula | C10H13Br2ClN2O2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 385.90 |
| IUPAC Name | methyl (2R)-2-amino-3-(4-amino-3,5-dibromophenyl)propanoate;hydrochloride |
| SMILES | COC(=O)[C@H](N)Cc1cc(Br)c(N)c(Br)c1.Cl |
| InChI | InChI=1S/C10H12Br2N2O2.ClH/c1-16-10(15)8(13)4-5-2-6(11)9(14)7(12)3-5;/h2-3,8H,4,13-14H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | WZGCCAUDJQUHKM-DDWIOCJRSA-N |
| XLogP | 2.26 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|