C10H13NO5 — CID 91499615
methyl 2-amino-3-(3,4,5-trihydroxyphenyl)propanoate (PubChem CID 91499615) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 2-amino-3-(3,4,5-trihydroxyphenyl)propanoate.
| Compound Name | methyl 2-amino-3-(3,4,5-trihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 91499615 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | methyl 2-amino-3-(3,4,5-trihydroxyphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C10H13NO5/c1-16-10(15)6(11)2-5-3-7(12)9(14)8(13)4-5/h3-4,6,12-14H,2,11H2,1H3 |
| InChIKey | BKYZHPUCEKXJLQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|