C11H11F2NO4 — CID 171238392
4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2,6-difluorobenzoic acid (PubChem CID 171238392) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2,6-difluorobenzoic acid.
| Compound Name | 4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 171238392 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-[(2S)-2-amino-3-methoxy-3-oxopropyl]-2,6-difluorobenzoic acid |
| SMILES | COC(=O)[C@@H](N)Cc1cc(F)c(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C11H11F2NO4/c1-18-11(17)8(14)4-5-2-6(12)9(10(15)16)7(13)3-5/h2-3,8H,4,14H2,1H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | DTCRUUSJCPBAAR-QMMMGPOBSA-N |
| XLogP | 0.71 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |