C11H12FNO4 — CID 171238482
2-[(2S)-2-amino-3-methoxy-3-oxopropyl]-6-fluorobenzoic acid (PubChem CID 171238482) has the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3-methoxy-3-oxopropyl]-6-fluorobenzoic acid.
| Compound Name | 2-[(2S)-2-amino-3-methoxy-3-oxopropyl]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 171238482 |
| Molecular Formula | C11H12FNO4 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-[(2S)-2-amino-3-methoxy-3-oxopropyl]-6-fluorobenzoic acid |
| SMILES | COC(=O)[C@@H](N)Cc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C11H12FNO4/c1-17-11(16)8(13)5-6-3-2-4-7(12)9(6)10(14)15/h2-4,8H,5,13H2,1H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | WNSOSSQLRQGAHV-QMMMGPOBSA-N |
| XLogP | 0.57 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |