C12H15F2NO3 — CID 170885235
ethyl 2-amino-3-(3,5-difluoro-4-methoxyphenyl)propanoate (PubChem CID 170885235) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is ethyl 2-amino-3-(3,5-difluoro-4-methoxyphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(3,5-difluoro-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 170885235 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | ethyl 2-amino-3-(3,5-difluoro-4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(F)c(OC)c(F)c1 |
| InChI | InChI=1S/C12H15F2NO3/c1-3-18-12(16)10(15)6-7-4-8(13)11(17-2)9(14)5-7/h4-5,10H,3,6,15H2,1-2H3 |
| InChIKey | FIWLMOLQMCDZAQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |