C16H22F2O3 — CID 70643369
ethyl 3-(4-butoxy-3,5-difluorophenyl)-2-methylpropanoate (PubChem CID 70643369) has the molecular formula C16H22F2O3 and a molecular weight of 300.35 g/mol. Its IUPAC name is ethyl 3-(4-butoxy-3,5-difluorophenyl)-2-methylpropanoate.
| Compound Name | ethyl 3-(4-butoxy-3,5-difluorophenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 70643369 |
| Molecular Formula | C16H22F2O3 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | ethyl 3-(4-butoxy-3,5-difluorophenyl)-2-methylpropanoate |
| SMILES | CCCCOc1c(F)cc(CC(C)C(=O)OCC)cc1F |
| InChI | InChI=1S/C16H22F2O3/c1-4-6-7-21-15-13(17)9-12(10-14(15)18)8-11(3)16(19)20-5-2/h9-11H,4-8H2,1-3H3 |
| InChIKey | YVUZPKOFXLOTQV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|