C20H25NO5 — CID 170885824
ethyl 2-amino-3-[4-(3,4,5-trimethoxyphenyl)phenyl]propanoate (PubChem CID 170885824) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is ethyl 2-amino-3-[4-(3,4,5-trimethoxyphenyl)phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[4-(3,4,5-trimethoxyphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 170885824 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | ethyl 2-amino-3-[4-(3,4,5-trimethoxyphenyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H25NO5/c1-5-26-20(22)16(21)10-13-6-8-14(9-7-13)15-11-17(23-2)19(25-4)18(12-15)24-3/h6-9,11-12,16H,5,10,21H2,1-4H3 |
| InChIKey | NOIBCRGAWSCCQZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |