C11H16N2O3 — CID 124559660
ethyl (2R)-2-amino-3-(2-methoxy-4-pyridinyl)propanoate (PubChem CID 124559660) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is ethyl (2R)-2-amino-3-(2-methoxy-4-pyridinyl)propanoate.
| Compound Name | ethyl (2R)-2-amino-3-(2-methoxy-4-pyridinyl)propanoate |
|---|---|
| PubChem CID | 124559660 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | ethyl (2R)-2-amino-3-(2-methoxy-4-pyridinyl)propanoate |
| SMILES | CCOC(=O)[C@H](N)Cc1ccnc(OC)c1 |
| InChI | InChI=1S/C11H16N2O3/c1-3-16-11(14)9(12)6-8-4-5-13-10(7-8)15-2/h4-5,7,9H,3,6,12H2,1-2H3/t9-/m1/s1 |
| InChIKey | VKKJEIBKKKWVJB-SECBINFHSA-N |
| XLogP | 0.52 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |