C12H18N2O3 — CID 62990254
ethyl 3-[(2-methoxy-4-pyridinyl)methylamino]propanoate (PubChem CID 62990254) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is ethyl 3-[(2-methoxy-4-pyridinyl)methylamino]propanoate.
| Compound Name | ethyl 3-[(2-methoxy-4-pyridinyl)methylamino]propanoate |
|---|---|
| PubChem CID | 62990254 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | ethyl 3-[(2-methoxy-4-pyridinyl)methylamino]propanoate |
| SMILES | CCOC(=O)CCNCc1ccnc(OC)c1 |
| InChI | InChI=1S/C12H18N2O3/c1-3-17-12(15)5-6-13-9-10-4-7-14-11(8-10)16-2/h4,7-8,13H,3,5-6,9H2,1-2H3 |
| InChIKey | BNAXKMVSJCXJHE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|