C12H19N3O2 — CID 62989370
3-[(2-methoxy-4-pyridinyl)methylamino]-N,N-dimethylpropanamide (PubChem CID 62989370) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-[(2-methoxy-4-pyridinyl)methylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(2-methoxy-4-pyridinyl)methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 62989370 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-[(2-methoxy-4-pyridinyl)methylamino]-N,N-dimethylpropanamide |
| SMILES | COc1cc(CNCCC(=O)N(C)C)ccn1 |
| InChI | InChI=1S/C12H19N3O2/c1-15(2)12(16)5-6-13-9-10-4-7-14-11(8-10)17-3/h4,7-8,13H,5-6,9H2,1-3H3 |
| InChIKey | CYHXWIHJIBQKQT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|