C14H22N2O2 — CID 54896362
3-[[3-(methoxymethyl)phenyl]methylamino]-N,N-dimethylpropanamide (PubChem CID 54896362) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-[[3-(methoxymethyl)phenyl]methylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[3-(methoxymethyl)phenyl]methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 54896362 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-[[3-(methoxymethyl)phenyl]methylamino]-N,N-dimethylpropanamide |
| SMILES | COCc1cccc(CNCCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-16(2)14(17)7-8-15-10-12-5-4-6-13(9-12)11-18-3/h4-6,9,15H,7-8,10-11H2,1-3H3 |
| InChIKey | PLDKAIZSRWAQTB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|