C13H17NO4 — CID 54333119
ethyl (2S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoate (PubChem CID 54333119) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is ethyl (2S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoate.
| Compound Name | ethyl (2S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoate |
|---|---|
| PubChem CID | 54333119 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | ethyl (2S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoate |
| SMILES | CCOC(=O)[C@@H](N)Cc1ccc(O)c(C(C)=O)c1 |
| InChI | InChI=1S/C13H17NO4/c1-3-18-13(17)11(14)7-9-4-5-12(16)10(6-9)8(2)15/h4-6,11,16H,3,7,14H2,1-2H3/t11-/m0/s1 |
| InChIKey | SZSJWHNYBSNRSZ-NSHDSACASA-N |
| XLogP | 1.03 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |