C11H15Cl2NO3 — CID 69314172
methyl (2S)-2-amino-3-(3-chloro-4-hydroxy-5-methylphenyl)propanoate;hydrochloride (PubChem CID 69314172) has the molecular formula C11H15Cl2NO3 and a molecular weight of 280.15 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(3-chloro-4-hydroxy-5-methylphenyl)propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-3-(3-chloro-4-hydroxy-5-methylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 69314172 |
| Molecular Formula | C11H15Cl2NO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | methyl (2S)-2-amino-3-(3-chloro-4-hydroxy-5-methylphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)Cc1cc(C)c(O)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H14ClNO3.ClH/c1-6-3-7(4-8(12)10(6)14)5-9(13)11(15)16-2;/h3-4,9,14H,5,13H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | LTFYFAQWVJJJEG-FVGYRXGTSA-N |
| XLogP | 1.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |