C16H19Br2NO2 — CID 25215572
N-but-3-enyl-2-[(3,5-dibromo-4-methoxyphenyl)methyl]but-3-enamide (PubChem CID 25215572) has the molecular formula C16H19Br2NO2 and a molecular weight of 417.14 g/mol. Its IUPAC name is N-but-3-enyl-2-[(3,5-dibromo-4-methoxyphenyl)methyl]but-3-enamide.
| Compound Name | N-but-3-enyl-2-[(3,5-dibromo-4-methoxyphenyl)methyl]but-3-enamide |
|---|---|
| PubChem CID | 25215572 |
| Molecular Formula | C16H19Br2NO2 |
| Molecular Weight | 417.14 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | N-but-3-enyl-2-[(3,5-dibromo-4-methoxyphenyl)methyl]but-3-enamide |
| SMILES | C=CCCNC(=O)C(C=C)Cc1cc(Br)c(OC)c(Br)c1 |
| InChI | InChI=1S/C16H19Br2NO2/c1-4-6-7-19-16(20)12(5-2)8-11-9-13(17)15(21-3)14(18)10-11/h4-5,9-10,12H,1-2,6-8H2,3H3,(H,19,20) |
| InChIKey | CFLCYIRVZKWGDI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.14 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|