C10H8Br2O2 — CID 144573982
1-(3,5-dibromo-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 144573982) has the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(3,5-dibromo-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 144573982 |
| Molecular Formula | C10H8Br2O2 |
| Molecular Weight | 319.98 g/mol |
| Exact Mass | 317.89 |
| IUPAC Name | 1-(3,5-dibromo-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | C=CC(=O)c1cc(Br)c(OC)c(Br)c1 |
| InChI | InChI=1S/C10H8Br2O2/c1-3-9(13)6-4-7(11)10(14-2)8(12)5-6/h3-5H,1H2,2H3 |
| InChIKey | VTXXFQWHQQDYFH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.98 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|