C9H10BrNO3 — CID 900808
3-bromo-4,5-dimethoxybenzamide (PubChem CID 900808) has the molecular formula C9H10BrNO3 and a molecular weight of 260.09 g/mol. Its IUPAC name is 3-bromo-4,5-dimethoxybenzamide.
| Compound Name | 3-bromo-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 900808 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 3-bromo-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)cc(Br)c1OC |
| InChI | InChI=1S/C9H10BrNO3/c1-13-7-4-5(9(11)12)3-6(10)8(7)14-2/h3-4H,1-2H3,(H2,11,12) |
| InChIKey | VGULIFJEXBRFIS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |