C10H13NO3 — CID 175729268
3,5-dimethoxy-4-(trideuteriomethyl)benzamide (PubChem CID 175729268) has the molecular formula C10H13NO3 and a molecular weight of 198.24 g/mol. Its IUPAC name is 3,5-dimethoxy-4-(trideuteriomethyl)benzamide.
| Compound Name | 3,5-dimethoxy-4-(trideuteriomethyl)benzamide |
|---|---|
| PubChem CID | 175729268 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 3,5-dimethoxy-4-(trideuteriomethyl)benzamide |
| SMILES | [2H]C([2H])([2H])c1c(OC)cc(C(N)=O)cc1OC |
| InChI | InChI=1S/C10H13NO3/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H2,11,12)/i1D3 |
| InChIKey | SUFQQNKRZVOZDM-FIBGUPNXSA-N |
| XLogP | 1.11 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |