C10H13NO4 — CID 175729183
3,4,5-tris(trideuteriomethoxy)benzamide (PubChem CID 175729183) has the molecular formula C10H13NO4 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3,4,5-tris(trideuteriomethoxy)benzamide.
| Compound Name | 3,4,5-tris(trideuteriomethoxy)benzamide |
|---|---|
| PubChem CID | 175729183 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3,4,5-tris(trideuteriomethoxy)benzamide |
| SMILES | [2H]C([2H])([2H])Oc1cc(C(N)=O)cc(OC([2H])([2H])[2H])c1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C10H13NO4/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H2,11,12)/i1D3,2D3,3D3 |
| InChIKey | GGNMTJKRHHLJHH-GQALSZNTSA-N |
| XLogP | 0.81 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |