C15H16N2O5 — CID 69475423
6-(3,4,5-trimethoxyphenoxy)pyridine-3-carboxamide (PubChem CID 69475423) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 6-(3,4,5-trimethoxyphenoxy)pyridine-3-carboxamide.
| Compound Name | 6-(3,4,5-trimethoxyphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69475423 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 6-(3,4,5-trimethoxyphenoxy)pyridine-3-carboxamide |
| SMILES | COc1cc(Oc2ccc(C(N)=O)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C15H16N2O5/c1-19-11-6-10(7-12(20-2)14(11)21-3)22-13-5-4-9(8-17-13)15(16)18/h4-8H,1-3H3,(H2,16,18) |
| InChIKey | WTZWHIKQRMGANS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |