6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid

C15H14N2O4 — CID 65454117

IUPAC6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid
SMILESCc1cc(C(N)=O)cc(C)c1Oc1ccc(C(=O)O)cn1
InChIInChI=1S/C15H14N2O4/c1-8-5-11(14(16)18)6-9(2)13(8)21-12-4-3-10(7-17-12)15(19)20/h3-7H,1-2H3,(H2,16,18)(H,19,20)
InChIKeyVFESTZDDRVCUQW-UHFFFAOYSA-N
MW286.29 g/mol
LogP2.29
Rot. Bonds4

About 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid

6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid (PubChem CID 65454117) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid
PubChem CID65454117
Molecular FormulaC15H14N2O4
Molecular Weight286.29 g/mol
Exact Mass286.10
IUPAC Name6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid
SMILESCc1cc(C(N)=O)cc(C)c1Oc1ccc(C(=O)O)cn1
InChIInChI=1S/C15H14N2O4/c1-8-5-11(14(16)18)6-9(2)13(8)21-12-4-3-10(7-17-12)15(19)20/h3-7H,1-2H3,(H2,16,18)(H,19,20)
InChIKeyVFESTZDDRVCUQW-UHFFFAOYSA-N
XLogP2.29
TPSA102.51 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.29
LogP ≤ 52.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid?
The IUPAC name of 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid (CID 65454117) is 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid?
The canonical SMILES for 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid is Cc1cc(C(N)=O)cc(C)c1Oc1ccc(C(=O)O)cn1.
What is the InChIKey of 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid?
The InChIKey is VFESTZDDRVCUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O4/c1-8-5-11(14(16)18)6-9(2)13(8)21-12-4-3-10(7-17-12)15(19)20/h3-7H,1-2H3,(H2,16,18)(H,19,20).
What are the key properties of 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid?
6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid has a molecular weight of 286.29 g/mol, XLogP of 2.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid is sourced from PubChem (CID 65454117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).