C15H14N2O4 — CID 65454117
6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid (PubChem CID 65454117) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid.
| Compound Name | 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 65454117 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 6-(4-carbamoyl-2,6-dimethylphenoxy)pyridine-3-carboxylic acid |
| SMILES | Cc1cc(C(N)=O)cc(C)c1Oc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C15H14N2O4/c1-8-5-11(14(16)18)6-9(2)13(8)21-12-4-3-10(7-17-12)15(19)20/h3-7H,1-2H3,(H2,16,18)(H,19,20) |
| InChIKey | VFESTZDDRVCUQW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |