C8H10N2O4S — CID 162641561
5-sulfamoyl-2-(trideuteriomethoxy)benzamide (PubChem CID 162641561) has the molecular formula C8H10N2O4S and a molecular weight of 233.26 g/mol. Its IUPAC name is 5-sulfamoyl-2-(trideuteriomethoxy)benzamide.
| Compound Name | 5-sulfamoyl-2-(trideuteriomethoxy)benzamide |
|---|---|
| PubChem CID | 162641561 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 5-sulfamoyl-2-(trideuteriomethoxy)benzamide |
| SMILES | [2H]C([2H])([2H])Oc1ccc(S(N)(=O)=O)cc1C(N)=O |
| InChI | InChI=1S/C8H10N2O4S/c1-14-7-3-2-5(15(10,12)13)4-6(7)8(9)11/h2-4H,1H3,(H2,9,11)(H2,10,12,13)/i1D3 |
| InChIKey | GTKYLVJCMKDNTH-FIBGUPNXSA-N |
| XLogP | -0.56 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |