C8H11ClN2O4S — CID 22748858
2-methoxy-5-sulfamoylbenzamide;hydrochloride (PubChem CID 22748858) has the molecular formula C8H11ClN2O4S and a molecular weight of 266.71 g/mol. Its IUPAC name is 2-methoxy-5-sulfamoylbenzamide;hydrochloride.
| Compound Name | 2-methoxy-5-sulfamoylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 22748858 |
| Molecular Formula | C8H11ClN2O4S |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-methoxy-5-sulfamoylbenzamide;hydrochloride |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(N)=O.Cl |
| InChI | InChI=1S/C8H10N2O4S.ClH/c1-14-7-3-2-5(15(10,12)13)4-6(7)8(9)11;/h2-4H,1H3,(H2,9,11)(H2,10,12,13);1H |
| InChIKey | ZKLBNFMQMWWDST-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |