C8H11KNO4S — CID 118692692
CID 118692692 (PubChem CID 118692692) has the molecular formula C8H11KNO4S and a molecular weight of 256.34 g/mol.
| Compound Name | CID 118692692 |
|---|---|
| PubChem CID | 118692692 |
| Molecular Formula | C8H11KNO4S |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | — |
| SMILES | COc1ccc(S(N)(=O)=O)cc1OC.[K] |
| InChI | InChI=1S/C8H11NO4S.K/c1-12-7-4-3-6(14(9,10)11)5-8(7)13-2;/h3-5H,1-2H3,(H2,9,10,11); |
| InChIKey | ZBFTYTIYDSKKMF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |