C10H10O4S — CID 10176908
4-ethynylsulfonyl-1,2-dimethoxybenzene (PubChem CID 10176908) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-ethynylsulfonyl-1,2-dimethoxybenzene.
| Compound Name | 4-ethynylsulfonyl-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 10176908 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-ethynylsulfonyl-1,2-dimethoxybenzene |
| SMILES | C#CS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C10H10O4S/c1-4-15(11,12)8-5-6-9(13-2)10(7-8)14-3/h1,5-7H,2-3H3 |
| InChIKey | OVQJABLALMLYCE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|