About 4-ethynylsulfonyl-1,2-dimethoxybenzene
4-ethynylsulfonyl-1,2-dimethoxybenzene (PubChem CID 10176908) has the molecular formula C10H10O4S
and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-ethynylsulfonyl-1,2-dimethoxybenzene.
Molecular Properties
| Compound Name | 4-ethynylsulfonyl-1,2-dimethoxybenzene |
| PubChem CID | 10176908 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-ethynylsulfonyl-1,2-dimethoxybenzene |
| SMILES | C#CS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C10H10O4S/c1-4-15(11,12)8-5-6-9(13-2)10(7-8)14-3/h1,5-7H,2-3H3 |
| InChIKey | OVQJABLALMLYCE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynylsulfonyl-1,2-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynylsulfonyl-1,2-dimethoxybenzene?
The IUPAC name of 4-ethynylsulfonyl-1,2-dimethoxybenzene (CID 10176908) is 4-ethynylsulfonyl-1,2-dimethoxybenzene.
What is the SMILES notation for 4-ethynylsulfonyl-1,2-dimethoxybenzene?
The canonical SMILES for 4-ethynylsulfonyl-1,2-dimethoxybenzene is C#CS(=O)(=O)c1ccc(OC)c(OC)c1.
What is the InChIKey of 4-ethynylsulfonyl-1,2-dimethoxybenzene?
The InChIKey is OVQJABLALMLYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4S/c1-4-15(11,12)8-5-6-9(13-2)10(7-8)14-3/h1,5-7H,2-3H3.
What are the key properties of 4-ethynylsulfonyl-1,2-dimethoxybenzene?
4-ethynylsulfonyl-1,2-dimethoxybenzene has a molecular weight of 226.25 g/mol, XLogP of 1.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynylsulfonyl-1,2-dimethoxybenzene is sourced from PubChem (CID 10176908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).