C8H9KO3 — CID 23662144
potassium 3,4-dimethoxyphenolate (PubChem CID 23662144) has the molecular formula C8H9KO3 and a molecular weight of 192.25 g/mol. Its IUPAC name is potassium 3,4-dimethoxyphenolate.
| Compound Name | potassium 3,4-dimethoxyphenolate |
|---|---|
| PubChem CID | 23662144 |
| Molecular Formula | C8H9KO3 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | potassium 3,4-dimethoxyphenolate |
| SMILES | COc1ccc([O-])cc1OC.[K+] |
| InChI | InChI=1S/C8H10O3.K/c1-10-7-4-3-6(9)5-8(7)11-2;/h3-5,9H,1-2H3;/q;+1/p-1 |
| InChIKey | CWSQFZPAYMAORQ-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |