C32H32O8 — CID 53328080
(4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,12,13,16-octamethoxytetraphenylene (PubChem CID 53328080) has the molecular formula C32H32O8 and a molecular weight of 544.60 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,12,13,16-octamethoxytetraphenylene.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,12,13,16-octamethoxytetraphenylene |
|---|---|
| PubChem CID | 53328080 |
| Molecular Formula | C32H32O8 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,12,13,16-octamethoxytetraphenylene |
| SMILES | COc1ccc(OC)c2/c1=c1/c(OC)ccc(OC)/c1=c1\c(OC)ccc(OC)\c1=c1/c(OC)ccc(OC)/c1=2 |
| InChI | InChI=1S/C32H32O8/c1-33-17-9-10-18(34-2)26-25(17)27-19(35-3)11-12-20(36-4)29(27)31-23(39-7)15-16-24(40-8)32(31)30-22(38-6)14-13-21(37-5)28(26)30/h9-16H,1-8H3/b27-25-,28-26-,31-29-,32-30- |
| InChIKey | HMXVIBWBPFXZAT-QKDICXLYSA-N |
| XLogP | 5.22 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |