C12H10I2O2 — CID 11236006
1,5-diiodo-4,8-dimethoxynaphthalene (PubChem CID 11236006) has the molecular formula C12H10I2O2 and a molecular weight of 440.02 g/mol. Its IUPAC name is 1,5-diiodo-4,8-dimethoxynaphthalene.
| Compound Name | 1,5-diiodo-4,8-dimethoxynaphthalene |
|---|---|
| PubChem CID | 11236006 |
| Molecular Formula | C12H10I2O2 |
| Molecular Weight | 440.02 g/mol |
| Exact Mass | 439.88 |
| IUPAC Name | 1,5-diiodo-4,8-dimethoxynaphthalene |
| SMILES | COc1ccc(I)c2c(OC)ccc(I)c12 |
| InChI | InChI=1S/C12H10I2O2/c1-15-9-5-3-8(14)12-10(16-2)6-4-7(13)11(9)12/h3-6H,1-2H3 |
| InChIKey | VXACRFIGIQXVIV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.02 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|