C9H12INO — CID 131552436
3-iodo-4-methoxy-N,N-dimethylaniline (PubChem CID 131552436) has the molecular formula C9H12INO and a molecular weight of 277.11 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N,N-dimethylaniline.
| Compound Name | 3-iodo-4-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 131552436 |
| Molecular Formula | C9H12INO |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 3-iodo-4-methoxy-N,N-dimethylaniline |
| SMILES | COc1ccc(N(C)C)cc1I |
| InChI | InChI=1S/C9H12INO/c1-11(2)7-4-5-9(12-3)8(10)6-7/h4-6H,1-3H3 |
| InChIKey | HJFRMPXVCCULHS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|