C9H12IN — CID 68650106
3-iodo-N,N,4-trimethylaniline (PubChem CID 68650106) has the molecular formula C9H12IN and a molecular weight of 261.11 g/mol. Its IUPAC name is 3-iodo-N,N,4-trimethylaniline.
| Compound Name | 3-iodo-N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 68650106 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 3-iodo-N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)cc1I |
| InChI | InChI=1S/C9H12IN/c1-7-4-5-8(11(2)3)6-9(7)10/h4-6H,1-3H3 |
| InChIKey | PQXCTCPXPUVRAN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|