C11H11I2N3 — CID 53309906
3-iodo-4-(5-iodopyrazol-1-yl)-N,N-dimethylaniline (PubChem CID 53309906) has the molecular formula C11H11I2N3 and a molecular weight of 439.04 g/mol. Its IUPAC name is 3-iodo-4-(5-iodopyrazol-1-yl)-N,N-dimethylaniline.
| Compound Name | 3-iodo-4-(5-iodopyrazol-1-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53309906 |
| Molecular Formula | C11H11I2N3 |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 438.90 |
| IUPAC Name | 3-iodo-4-(5-iodopyrazol-1-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-n2nccc2I)c(I)c1 |
| InChI | InChI=1S/C11H11I2N3/c1-15(2)8-3-4-10(9(12)7-8)16-11(13)5-6-14-16/h3-7H,1-2H3 |
| InChIKey | HWJOQPNZZPGRBV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|