C16H17IN2 — CID 1381576
4-[(3-iodo-4-methylphenyl)iminomethyl]-N,N-dimethylaniline (PubChem CID 1381576) has the molecular formula C16H17IN2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 4-[(3-iodo-4-methylphenyl)iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(3-iodo-4-methylphenyl)iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 1381576 |
| Molecular Formula | C16H17IN2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 4-[(3-iodo-4-methylphenyl)iminomethyl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(/N=C/c2ccc(N(C)C)cc2)cc1I |
| InChI | InChI=1S/C16H17IN2/c1-12-4-7-14(10-16(12)17)18-11-13-5-8-15(9-6-13)19(2)3/h4-11H,1-3H3/b18-11+ |
| InChIKey | VJNVRNWPGMDJCV-WOJGMQOQSA-N |
| XLogP | 4.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|