C15H11F4IN2 — CID 139203663
N,N-dimethyl-4-[(2,3,5,6-tetrafluoro-4-iodophenyl)iminomethyl]aniline (PubChem CID 139203663) has the molecular formula C15H11F4IN2 and a molecular weight of 422.16 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2,3,5,6-tetrafluoro-4-iodophenyl)iminomethyl]aniline.
| Compound Name | N,N-dimethyl-4-[(2,3,5,6-tetrafluoro-4-iodophenyl)iminomethyl]aniline |
|---|---|
| PubChem CID | 139203663 |
| Molecular Formula | C15H11F4IN2 |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | N,N-dimethyl-4-[(2,3,5,6-tetrafluoro-4-iodophenyl)iminomethyl]aniline |
| SMILES | CN(C)c1ccc(/C=N/c2c(F)c(F)c(I)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H11F4IN2/c1-22(2)9-5-3-8(4-6-9)7-21-15-12(18)10(16)14(20)11(17)13(15)19/h3-7H,1-2H3/b21-7+ |
| InChIKey | XCCOQEPXLUZOAG-QPSGOUHRSA-N |
| XLogP | 4.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|