C13H16N6O — CID 137048022
2,4-diamino-5-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrimidin-6-one (PubChem CID 137048022) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 2,4-diamino-5-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137048022 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2,4-diamino-5-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrimidin-6-one |
| SMILES | CN(C)c1ccc(/C=N/c2c(N)nc(N)[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H16N6O/c1-19(2)9-5-3-8(4-6-9)7-16-10-11(14)17-13(15)18-12(10)20/h3-7H,1-2H3,(H5,14,15,17,18,20)/b16-7+ |
| InChIKey | RFUKDMCZJHJFES-FRKPEAEDSA-N |
| XLogP | 0.75 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|