C19H24N8O5 — CID 135774207
2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 135774207) has the molecular formula C19H24N8O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135774207 |
| Molecular Formula | C19H24N8O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | CN(C)c1ccc(/C=N\Nc2nc3c(=O)[nH]c(N)nc3n2[C@@H]2O[C@@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C19H24N8O5/c1-26(2)10-5-3-9(4-6-10)7-21-25-19-22-12-15(23-18(20)24-16(12)31)27(19)17-14(30)13(29)11(8-28)32-17/h3-7,11,13-14,17,28-30H,8H2,1-2H3,(H,22,25)(H3,20,23,24,31)/b21-7-/t11-,13+,14+,17+/m0/s1 |
| InChIKey | STHKNNLRWCJMPL-XUNCZMBYSA-N |
| XLogP | -1.17 |
| TPSA | 187.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|