C15H16N8O8 — CID 137081231
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 137081231) has the molecular formula C15H16N8O8 and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137081231 |
| Molecular Formula | C15H16N8O8 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N/N=C\c3ccc([N+](=O)[O-])o3)n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N8O8/c16-14-19-11-8(12(27)20-14)18-15(21-17-3-5-1-2-7(30-5)23(28)29)22(11)13-10(26)9(25)6(4-24)31-13/h1-3,6,9-10,13,24-26H,4H2,(H,18,21)(H3,16,19,20,27)/b17-3-/t6-,9-,10-,13-/m1/s1 |
| InChIKey | OXGYOIYULNIVTO-OQGKWKKOSA-N |
| XLogP | -1.74 |
| TPSA | 240.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|