C19H23BrN8O5 — CID 135495367
2-amino-8-[2-[[3-bromo-4-(dimethylamino)phenyl]methylidene]hydrazinyl]-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135495367) has the molecular formula C19H23BrN8O5 and a molecular weight of 523.35 g/mol. Its IUPAC name is 2-amino-8-[2-[[3-bromo-4-(dimethylamino)phenyl]methylidene]hydrazinyl]-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-8-[2-[[3-bromo-4-(dimethylamino)phenyl]methylidene]hydrazinyl]-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135495367 |
| Molecular Formula | C19H23BrN8O5 |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 2-amino-8-[2-[[3-bromo-4-(dimethylamino)phenyl]methylidene]hydrazinyl]-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CN(C)c1ccc(C=NNc2nc3c(=O)[nH]c(N)nc3n2C2OC(CO)C(O)C2O)cc1Br |
| InChI | InChI=1S/C19H23BrN8O5/c1-27(2)10-4-3-8(5-9(10)20)6-22-26-19-23-12-15(24-18(21)25-16(12)32)28(19)17-14(31)13(30)11(7-29)33-17/h3-6,11,13-14,17,29-31H,7H2,1-2H3,(H,23,26)(H3,21,24,25,32) |
| InChIKey | WHDWGAZLPKNHGL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 187.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|