C22H28N10O7 — CID 137081226
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 137081226) has the molecular formula C22H28N10O7 and a molecular weight of 544.53 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137081226 |
| Molecular Formula | C22H28N10O7 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | CN1CCN(c2ccc(/C=N\Nc3nc4c(=O)[nH]c(N)nc4n3[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H28N10O7/c1-29-4-6-30(7-5-29)12-3-2-11(8-13(12)32(37)38)9-24-28-22-25-15-18(26-21(23)27-19(15)36)31(22)20-17(35)16(34)14(10-33)39-20/h2-3,8-9,14,16-17,20,33-35H,4-7,10H2,1H3,(H,25,28)(H3,23,26,27,36)/b24-9-/t14-,16-,17-,20-/m1/s1 |
| InChIKey | NNZNKOHVTJTPFL-JEYYLDKPSA-N |
| XLogP | -1.58 |
| TPSA | 233.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|