C19H23N7O6 — CID 135683564
2-[6-amino-8-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 135683564) has the molecular formula C19H23N7O6 and a molecular weight of 445.44 g/mol. Its IUPAC name is 2-[6-amino-8-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-amino-8-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 135683564 |
| Molecular Formula | C19H23N7O6 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-[6-amino-8-[(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCOc1cc(/C=N/Nc2nc3c(N)ncnc3n2C2OC(CO)C(O)C2O)ccc1O |
| InChI | InChI=1S/C19H23N7O6/c1-2-31-11-5-9(3-4-10(11)28)6-23-25-19-24-13-16(20)21-8-22-17(13)26(19)18-15(30)14(29)12(7-27)32-18/h3-6,8,12,14-15,18,27-30H,2,7H2,1H3,(H,24,25)(H2,20,21,22)/b23-6+ |
| InChIKey | YEWNJKRYLJZELI-TXNBCWFRSA-N |
| XLogP | -0.43 |
| TPSA | 193.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|