C18H21N7O5 — CID 51443517
(2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 51443517) has the molecular formula C18H21N7O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 51443517 |
| Molecular Formula | C18H21N7O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1ccc(/C=N\Nc2nc3c(N)ncnc3n2[C@H]2O[C@@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C18H21N7O5/c1-29-10-4-2-9(3-5-10)6-22-24-18-23-12-15(19)20-8-21-16(12)25(18)17-14(28)13(27)11(7-26)30-17/h2-6,8,11,13-14,17,26-28H,7H2,1H3,(H,23,24)(H2,19,20,21)/b22-6-/t11-,13+,14+,17-/m0/s1 |
| InChIKey | FKUNDSQGUUSYPH-UZRLYKFASA-N |
| XLogP | -0.53 |
| TPSA | 173.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|