C17H18ClN7O4 — CID 51443521
(2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 51443521) has the molecular formula C17H18ClN7O4 and a molecular weight of 419.83 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 51443521 |
| Molecular Formula | C17H18ClN7O4 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (2S,3R,4S,5S)-2-[6-amino-8-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(N/N=C\c1ccc(Cl)cc1)n2[C@H]1O[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18ClN7O4/c18-9-3-1-8(2-4-9)5-22-24-17-23-11-14(19)20-7-21-15(11)25(17)16-13(28)12(27)10(6-26)29-16/h1-5,7,10,12-13,16,26-28H,6H2,(H,23,24)(H2,19,20,21)/b22-5-/t10-,12+,13+,16-/m0/s1 |
| InChIKey | QXZWHITXPDXLPY-NDUBCVILSA-N |
| XLogP | 0.12 |
| TPSA | 163.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|