C17H19N7O5 — CID 136783647
(2R,3R,4S,5R)-2-[6-amino-8-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 136783647) has the molecular formula C17H19N7O5 and a molecular weight of 401.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 136783647 |
| Molecular Formula | C17H19N7O5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(N/N=C\c1ccc(O)cc1)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H19N7O5/c18-14-11-15(20-7-19-14)24(16-13(28)12(27)10(6-25)29-16)17(22-11)23-21-5-8-1-3-9(26)4-2-8/h1-5,7,10,12-13,16,25-28H,6H2,(H,22,23)(H2,18,19,20)/b21-5-/t10-,12-,13-,16-/m1/s1 |
| InChIKey | UUWMKIXWBJBBFG-QGRJEIQKSA-N |
| XLogP | -0.83 |
| TPSA | 184.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|