C19H23N7O5 — CID 2814995
(2S,3S,4R,5S)-2-[6-amino-8-[2-[(2-ethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 2814995) has the molecular formula C19H23N7O5 and a molecular weight of 429.44 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-[6-amino-8-[2-[(2-ethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5S)-2-[6-amino-8-[2-[(2-ethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 2814995 |
| Molecular Formula | C19H23N7O5 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (2S,3S,4R,5S)-2-[6-amino-8-[2-[(2-ethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCOc1ccccc1C=NNc1nc2c(N)ncnc2n1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23N7O5/c1-2-30-11-6-4-3-5-10(11)7-23-25-19-24-13-16(20)21-9-22-17(13)26(19)18-15(29)14(28)12(8-27)31-18/h3-7,9,12,14-15,18,27-29H,2,8H2,1H3,(H,24,25)(H2,20,21,22)/t12-,14-,15-,18-/m0/s1 |
| InChIKey | FUQMJTSHRCAXGW-OWCBBSPXSA-N |
| XLogP | -0.14 |
| TPSA | 173.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|