C17H20N8O4 — CID 3581878
2-[6-amino-8-[2-(1-pyridin-2-ylethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 3581878) has the molecular formula C17H20N8O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-[6-amino-8-[2-(1-pyridin-2-ylethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-amino-8-[2-(1-pyridin-2-ylethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 3581878 |
| Molecular Formula | C17H20N8O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[6-amino-8-[2-(1-pyridin-2-ylethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(=NNc1nc2c(N)ncnc2n1C1OC(CO)C(O)C1O)c1ccccn1 |
| InChI | InChI=1S/C17H20N8O4/c1-8(9-4-2-3-5-19-9)23-24-17-22-11-14(18)20-7-21-15(11)25(17)16-13(28)12(27)10(6-26)29-16/h2-5,7,10,12-13,16,26-28H,6H2,1H3,(H,22,24)(H2,18,20,21) |
| InChIKey | ADMJMWMBJQULCB-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 176.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|