C19H22BrN7O5 — CID 3933594
2-[6-amino-8-[2-[1-(2-bromophenoxy)propan-2-ylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 3933594) has the molecular formula C19H22BrN7O5 and a molecular weight of 508.33 g/mol. Its IUPAC name is 2-[6-amino-8-[2-[1-(2-bromophenoxy)propan-2-ylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-amino-8-[2-[1-(2-bromophenoxy)propan-2-ylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 3933594 |
| Molecular Formula | C19H22BrN7O5 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 2-[6-amino-8-[2-[1-(2-bromophenoxy)propan-2-ylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(COc1ccccc1Br)=NNc1nc2c(N)ncnc2n1C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C19H22BrN7O5/c1-9(7-31-11-5-3-2-4-10(11)20)25-26-19-24-13-16(21)22-8-23-17(13)27(19)18-15(30)14(29)12(6-28)32-18/h2-5,8,12,14-15,18,28-30H,6-7H2,1H3,(H,24,26)(H2,21,22,23) |
| InChIKey | BEIMPFLKEIFNFA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 173.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|