C18H22N6O5 — CID 59034992
(2R,3R,4S,5R)-2-[6-amino-8-(2-phenoxyethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 59034992) has the molecular formula C18H22N6O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-(2-phenoxyethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-(2-phenoxyethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59034992 |
| Molecular Formula | C18H22N6O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-(2-phenoxyethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(NCCOc1ccccc1)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H22N6O5/c19-15-12-16(22-9-21-15)24(17-14(27)13(26)11(8-25)29-17)18(23-12)20-6-7-28-10-4-2-1-3-5-10/h1-5,9,11,13-14,17,25-27H,6-8H2,(H,20,23)(H2,19,21,22)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | XEPYHTGCRQZOTL-LSCFUAHRSA-N |
| XLogP | -0.49 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|