C28H35N7O5 — CID 67456224
(2R,5R)-2-[6-amino-8-[[3-[3-(ethylamino)propoxy]-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 67456224) has the molecular formula C28H35N7O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is (2R,5R)-2-[6-amino-8-[[3-[3-(ethylamino)propoxy]-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-amino-8-[[3-[3-(ethylamino)propoxy]-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 67456224 |
| Molecular Formula | C28H35N7O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (2R,5R)-2-[6-amino-8-[[3-[3-(ethylamino)propoxy]-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCNCCCOc1cc(CNc2nc3c(N)ncnc3n2[C@@H]2O[C@H](CO)C(O)C2O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C28H35N7O5/c1-2-30-11-6-12-39-20-13-17(9-10-19(20)18-7-4-3-5-8-18)14-31-28-34-22-25(29)32-16-33-26(22)35(28)27-24(38)23(37)21(15-36)40-27/h3-5,7-10,13,16,21,23-24,27,30,36-38H,2,6,11-12,14-15H2,1H3,(H,31,34)(H2,29,32,33)/t21-,23?,24?,27-/m1/s1 |
| InChIKey | BGRWTHTZDQAQJB-ANEXQRMUSA-N |
| XLogP | 1.68 |
| TPSA | 172.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|