C28H34N8O5 — CID 59460387
5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-N-[2-(dimethylamino)ethyl]-2-phenylbenzamide (PubChem CID 59460387) has the molecular formula C28H34N8O5 and a molecular weight of 562.63 g/mol. Its IUPAC name is 5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-N-[2-(dimethylamino)ethyl]-2-phenylbenzamide.
| Compound Name | 5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-N-[2-(dimethylamino)ethyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 59460387 |
| Molecular Formula | C28H34N8O5 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | 5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-N-[2-(dimethylamino)ethyl]-2-phenylbenzamide |
| SMILES | CN(C)CCNC(=O)c1cc(CNc2nc3c(N)ncnc3n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C28H34N8O5/c1-35(2)11-10-30-26(40)19-12-16(8-9-18(19)17-6-4-3-5-7-17)13-31-28-34-21-24(29)32-15-33-25(21)36(28)27-23(39)22(38)20(14-37)41-27/h3-9,12,15,20,22-23,27,37-39H,10-11,13-14H2,1-2H3,(H,30,40)(H,31,34)(H2,29,32,33)/t20-,22-,23-,27-/m1/s1 |
| InChIKey | PZPDGJZICJZRSV-TXJANDSUSA-N |
| XLogP | 0.59 |
| TPSA | 183.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |